N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-N'-ethyl-N-[(furan-2-yl)methyl]thiourea
Chemical Structure Depiction of
N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-N'-ethyl-N-[(furan-2-yl)methyl]thiourea
N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-N'-ethyl-N-[(furan-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C449-0163 |
| Compound Name: | N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-N'-ethyl-N-[(furan-2-yl)methyl]thiourea |
| Molecular Weight: | 355.5 |
| Molecular Formula: | C20 H25 N3 O S |
| Smiles: | CCNC(N(CCc1c2cc(C)ccc2[nH]c1C)Cc1ccco1)=S |
| Stereo: | ACHIRAL |
| logP: | 4.5266 |
| logD: | 4.5266 |
| logSw: | -4.2496 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 29.3005 |
| InChI Key: | FRMFVZJJAMXHDB-UHFFFAOYSA-N |