6-[(4-propoxyphenyl)methyl]-2-[(4-propoxyphenyl)methylidene]-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
Chemical Structure Depiction of
6-[(4-propoxyphenyl)methyl]-2-[(4-propoxyphenyl)methylidene]-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
6-[(4-propoxyphenyl)methyl]-2-[(4-propoxyphenyl)methylidene]-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
Compound characteristics
| Compound ID: | C451-0174 |
| Compound Name: | 6-[(4-propoxyphenyl)methyl]-2-[(4-propoxyphenyl)methylidene]-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione |
| Molecular Weight: | 463.55 |
| Molecular Formula: | C25 H25 N3 O4 S |
| Smiles: | CCCOc1ccc(CC2C(N=C3N(C(/C(=C\c4ccc(cc4)OCCC)S3)=O)N=2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0311 |
| logD: | 5.0311 |
| logSw: | -4.6158 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.387 |
| InChI Key: | GZMYOWNDAIWHFU-UHFFFAOYSA-N |