N-(3-ethoxypropyl)-3-(3-methoxyphenyl)-1-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
Chemical Structure Depiction of
N-(3-ethoxypropyl)-3-(3-methoxyphenyl)-1-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
N-(3-ethoxypropyl)-3-(3-methoxyphenyl)-1-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | C453-0167 |
| Compound Name: | N-(3-ethoxypropyl)-3-(3-methoxyphenyl)-1-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide |
| Molecular Weight: | 373.47 |
| Molecular Formula: | C19 H23 N3 O3 S |
| Smiles: | CCOCCCNC(c1cc2c(c3cccc(c3)OC)nn(C)c2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9813 |
| logD: | 2.9813 |
| logSw: | -3.3523 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.404 |
| InChI Key: | IERXJFUUWQGMQR-UHFFFAOYSA-N |