3-(3,4-dimethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]-1H-thieno[2,3-c]pyrazole-5-carboxamide
Chemical Structure Depiction of
3-(3,4-dimethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]-1H-thieno[2,3-c]pyrazole-5-carboxamide
3-(3,4-dimethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]-1H-thieno[2,3-c]pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | C453-0443 |
| Compound Name: | 3-(3,4-dimethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]-1H-thieno[2,3-c]pyrazole-5-carboxamide |
| Molecular Weight: | 421.52 |
| Molecular Formula: | C23 H23 N3 O3 S |
| Smiles: | Cc1ccc(CNC(c2cc3c(c4ccc(c(c4)OC)OC)nn(C)c3s2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9707 |
| logD: | 3.9707 |
| logSw: | -4.0695 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.03 |
| InChI Key: | GPEAKSXDKKWOHK-UHFFFAOYSA-N |