N~2~-(2,1,3-benzothiadiazole-4-sulfonyl)-N-(2,3-dimethylphenyl)-N~2~-methylglycinamide
Chemical Structure Depiction of
N~2~-(2,1,3-benzothiadiazole-4-sulfonyl)-N-(2,3-dimethylphenyl)-N~2~-methylglycinamide
N~2~-(2,1,3-benzothiadiazole-4-sulfonyl)-N-(2,3-dimethylphenyl)-N~2~-methylglycinamide
Compound characteristics
| Compound ID: | C481-0397 |
| Compound Name: | N~2~-(2,1,3-benzothiadiazole-4-sulfonyl)-N-(2,3-dimethylphenyl)-N~2~-methylglycinamide |
| Molecular Weight: | 390.48 |
| Molecular Formula: | C17 H18 N4 O3 S2 |
| Smiles: | Cc1cccc(c1C)NC(CN(C)S(c1cccc2c1nsn2)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1803 |
| logD: | 3.1803 |
| logSw: | -3.1609 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.207 |
| InChI Key: | XXPOWEQKVODSDW-UHFFFAOYSA-N |