N-[2-(4-benzylpiperazin-1-yl)-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide
Chemical Structure Depiction of
N-[2-(4-benzylpiperazin-1-yl)-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide
N-[2-(4-benzylpiperazin-1-yl)-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide
Compound characteristics
| Compound ID: | C481-0968 |
| Compound Name: | N-[2-(4-benzylpiperazin-1-yl)-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| Molecular Weight: | 507.63 |
| Molecular Formula: | C25 H25 N5 O3 S2 |
| Smiles: | C1CN(CCN1Cc1ccccc1)C(C(c1ccccc1)NS(c1cccc2c1nsn2)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9967 |
| logD: | 2.7657 |
| logSw: | -3.3284 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.704 |
| InChI Key: | BQBKRZDCDYRBAA-HSZRJFAPSA-N |