methyl 4-{2-[(2,1,3-benzothiadiazole-4-sulfonyl)amino](phenyl)acetamido}benzoate
Chemical Structure Depiction of
methyl 4-{2-[(2,1,3-benzothiadiazole-4-sulfonyl)amino](phenyl)acetamido}benzoate
methyl 4-{2-[(2,1,3-benzothiadiazole-4-sulfonyl)amino](phenyl)acetamido}benzoate
Compound characteristics
| Compound ID: | C481-1381 |
| Compound Name: | methyl 4-{2-[(2,1,3-benzothiadiazole-4-sulfonyl)amino](phenyl)acetamido}benzoate |
| Molecular Weight: | 482.54 |
| Molecular Formula: | C22 H18 N4 O5 S2 |
| Smiles: | COC(c1ccc(cc1)NC(C(c1ccccc1)NS(c1cccc2c1nsn2)(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4519 |
| logD: | 3.3594 |
| logSw: | -3.7972 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 106.78 |
| InChI Key: | KWCMYNAMAPWGMQ-LJQANCHMSA-N |