N-[(furan-2-yl)methyl]-1-[(2-methylphenyl)methyl]-2,4-dioxo-3-phenyl-1,2,3,4-tetrahydroquinazoline-7-carboxamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-1-[(2-methylphenyl)methyl]-2,4-dioxo-3-phenyl-1,2,3,4-tetrahydroquinazoline-7-carboxamide
N-[(furan-2-yl)methyl]-1-[(2-methylphenyl)methyl]-2,4-dioxo-3-phenyl-1,2,3,4-tetrahydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | C487-0001 |
| Compound Name: | N-[(furan-2-yl)methyl]-1-[(2-methylphenyl)methyl]-2,4-dioxo-3-phenyl-1,2,3,4-tetrahydroquinazoline-7-carboxamide |
| Molecular Weight: | 465.51 |
| Molecular Formula: | C28 H23 N3 O4 |
| Smiles: | Cc1ccccc1CN1C(N(C(c2ccc(cc12)C(NCc1ccco1)=O)=O)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6849 |
| logD: | 4.6848 |
| logSw: | -4.3635 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.817 |
| InChI Key: | ANRWQMGVDWSTIT-UHFFFAOYSA-N |