5-methyl-4-oxo-N-(4-phenoxyphenyl)-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide
Chemical Structure Depiction of
5-methyl-4-oxo-N-(4-phenoxyphenyl)-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide
5-methyl-4-oxo-N-(4-phenoxyphenyl)-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide
Compound characteristics
| Compound ID: | C498-0485 |
| Compound Name: | 5-methyl-4-oxo-N-(4-phenoxyphenyl)-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide |
| Molecular Weight: | 426.49 |
| Molecular Formula: | C25 H18 N2 O3 S |
| Smiles: | CN1C(c2cc(C(Nc3ccc(cc3)Oc3ccccc3)=O)sc2c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4812 |
| logD: | 5.4812 |
| logSw: | -5.4581 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.964 |
| InChI Key: | HKHDCRVUDCFXJE-UHFFFAOYSA-N |