3-(3-chloro-4-methoxyphenyl)-5-methyl-4-oxo-N-(quinolin-3-yl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Chemical Structure Depiction of
3-(3-chloro-4-methoxyphenyl)-5-methyl-4-oxo-N-(quinolin-3-yl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
3-(3-chloro-4-methoxyphenyl)-5-methyl-4-oxo-N-(quinolin-3-yl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Compound characteristics
| Compound ID: | C507-0005 |
| Compound Name: | 3-(3-chloro-4-methoxyphenyl)-5-methyl-4-oxo-N-(quinolin-3-yl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide |
| Molecular Weight: | 509.95 |
| Molecular Formula: | C28 H20 Cl N5 O3 |
| Smiles: | Cn1c2C(N(c3ccc(c(c3)[Cl])OC)N=C(C(Nc3cc4ccccc4nc3)=O)c2c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8342 |
| logD: | 4.8341 |
| logSw: | -5.339 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.545 |
| InChI Key: | HLSZYXMJLPRQFL-UHFFFAOYSA-N |