3-(3-chloro-4-methoxyphenyl)-N-(2-chloro-4-methylphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Chemical Structure Depiction of
3-(3-chloro-4-methoxyphenyl)-N-(2-chloro-4-methylphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
3-(3-chloro-4-methoxyphenyl)-N-(2-chloro-4-methylphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Compound characteristics
| Compound ID: | C507-0193 |
| Compound Name: | 3-(3-chloro-4-methoxyphenyl)-N-(2-chloro-4-methylphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide |
| Molecular Weight: | 507.38 |
| Molecular Formula: | C26 H20 Cl2 N4 O3 |
| Smiles: | Cc1ccc(c(c1)[Cl])NC(C1c2c3ccccc3n(C)c2C(N(c2ccc(c(c2)[Cl])OC)N=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4625 |
| logD: | 5.4599 |
| logSw: | -6.2562 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.994 |
| InChI Key: | PSFSQPKBYSLUGR-UHFFFAOYSA-N |