[3-(4-chlorophenyl)-1-methyl-1H-thieno[2,3-c]pyrazol-5-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
[3-(4-chlorophenyl)-1-methyl-1H-thieno[2,3-c]pyrazol-5-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
[3-(4-chlorophenyl)-1-methyl-1H-thieno[2,3-c]pyrazol-5-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | C509-0169 |
| Compound Name: | [3-(4-chlorophenyl)-1-methyl-1H-thieno[2,3-c]pyrazol-5-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone |
| Molecular Weight: | 504.96 |
| Molecular Formula: | C24 H20 Cl F3 N4 O S |
| Smiles: | Cn1c2c(cc(C(N3CCN(CC3)c3cccc(c3)C(F)(F)F)=O)s2)c(c2ccc(cc2)[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 5.5388 |
| logD: | 5.5388 |
| logSw: | -6.1616 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 35.265 |
| InChI Key: | LJAVRTRLDNNLSA-UHFFFAOYSA-N |