2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-(2,4-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-(2,4-dimethoxyphenyl)acetamide
2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-(2,4-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | C509-0722 |
| Compound Name: | 2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-(2,4-dimethoxyphenyl)acetamide |
| Molecular Weight: | 442.96 |
| Molecular Formula: | C23 H23 Cl N2 O3 S |
| Smiles: | COc1ccc(c(c1)OC)NC(CSc1c2CCCCc2nc2ccc(cc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.3841 |
| logD: | 4.9332 |
| logSw: | -5.8841 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.345 |
| InChI Key: | MTYOFCSYOLVONU-UHFFFAOYSA-N |