N-(2-bromo-4-methylphenyl)-7-chloro-1,2,3,4-tetrahydroacridin-9-amine
Chemical Structure Depiction of
N-(2-bromo-4-methylphenyl)-7-chloro-1,2,3,4-tetrahydroacridin-9-amine
N-(2-bromo-4-methylphenyl)-7-chloro-1,2,3,4-tetrahydroacridin-9-amine
Compound characteristics
| Compound ID: | C509-1420 |
| Compound Name: | N-(2-bromo-4-methylphenyl)-7-chloro-1,2,3,4-tetrahydroacridin-9-amine |
| Molecular Weight: | 401.73 |
| Molecular Formula: | C20 H18 Br Cl N2 |
| Smiles: | Cc1ccc(c(c1)[Br])Nc1c2CCCCc2nc2ccc(cc12)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.8858 |
| logD: | 4.6112 |
| logSw: | -6.4012 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 16.8095 |
| InChI Key: | HCSZABMUQDJDSW-UHFFFAOYSA-N |