3-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)quinazolin-4(3H)-one
3-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | C512-0083 |
| Compound Name: | 3-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)quinazolin-4(3H)-one |
| Molecular Weight: | 410.52 |
| Molecular Formula: | C26 H26 N4 O |
| Smiles: | CCc1ccc(cc1)N1C(=Nc2ccccc2C1=O)N1CCN(CC1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5461 |
| logD: | 4.5444 |
| logSw: | -4.3728 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.4714 |
| InChI Key: | XWOHYPMUGKTXQT-UHFFFAOYSA-N |