N-(3,4-dimethoxyphenyl)-1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
N-(3,4-dimethoxyphenyl)-1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C514-0119 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide |
| Molecular Weight: | 517.62 |
| Molecular Formula: | C24 H27 N3 O6 S2 |
| Smiles: | Cc1c(c(/C=C/c2cccs2)on1)S(N1CCC(CC1)C(Nc1ccc(c(c1)OC)OC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5469 |
| logD: | 2.5467 |
| logSw: | -3.0267 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 92.835 |
| InChI Key: | XZOZBRFXQBDVJX-UHFFFAOYSA-N |