N-{3-[benzyl(methyl)amino]propyl}-N~2~-(4-methoxyphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
Chemical Structure Depiction of
N-{3-[benzyl(methyl)amino]propyl}-N~2~-(4-methoxyphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
N-{3-[benzyl(methyl)amino]propyl}-N~2~-(4-methoxyphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | C517-1633 |
| Compound Name: | N-{3-[benzyl(methyl)amino]propyl}-N~2~-(4-methoxyphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide |
| Molecular Weight: | 513.66 |
| Molecular Formula: | C26 H35 N5 O4 S |
| Smiles: | Cc1c(c(C)n(C)n1)S(N(CC(NCCCN(C)Cc1ccccc1)=O)c1ccc(cc1)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5114 |
| logD: | 0.0141 |
| logSw: | -2.3942 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.582 |
| InChI Key: | RHIJOESQIJNHGI-UHFFFAOYSA-N |