N-[(2-methoxyphenyl)methyl]-3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide
Chemical Structure Depiction of
N-[(2-methoxyphenyl)methyl]-3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide
N-[(2-methoxyphenyl)methyl]-3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide
Compound characteristics
| Compound ID: | C517-5344 |
| Compound Name: | N-[(2-methoxyphenyl)methyl]-3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide |
| Molecular Weight: | 348.38 |
| Molecular Formula: | C16 H16 N2 O5 S |
| Smiles: | CN1C(=O)Oc2cc(ccc12)S(NCc1ccccc1OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2993 |
| logD: | 2.299 |
| logSw: | -2.9534 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.493 |
| InChI Key: | KDGBYRCCZURMCO-UHFFFAOYSA-N |