ethyl 3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]benzoate
Chemical Structure Depiction of
ethyl 3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]benzoate
ethyl 3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]benzoate
Compound characteristics
| Compound ID: | C518-0192 |
| Compound Name: | ethyl 3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]benzoate |
| Molecular Weight: | 380.87 |
| Molecular Formula: | C22 H21 Cl N2 O2 |
| Smiles: | CCOC(c1cccc(c1)Nc1c2CCCCc2nc2cc(ccc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.5622 |
| logD: | 4.2876 |
| logSw: | -6.3519 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.261 |
| InChI Key: | GGUZYLZYRKLJEQ-UHFFFAOYSA-N |