N-[(4-chlorophenyl)methyl]-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide
N-[(4-chlorophenyl)methyl]-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | C519-0669 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide |
| Molecular Weight: | 502.03 |
| Molecular Formula: | C25 H28 Cl N3 O4 S |
| Smiles: | CN1C=C(C(c2cc(ccc12)S(N(C)C1CCCCC1)(=O)=O)=O)C(NCc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.8901 |
| logD: | 3.8897 |
| logSw: | -4.3899 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.617 |
| InChI Key: | ARWPAANXVMIXID-UHFFFAOYSA-N |