N-{3-[butyl(ethyl)amino]propyl}-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-{3-[butyl(ethyl)amino]propyl}-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide
N-{3-[butyl(ethyl)amino]propyl}-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | C519-0710 |
| Compound Name: | N-{3-[butyl(ethyl)amino]propyl}-6-[cyclohexyl(methyl)sulfamoyl]-1-methyl-4-oxo-1,4-dihydroquinoline-3-carboxamide |
| Molecular Weight: | 518.72 |
| Molecular Formula: | C27 H42 N4 O4 S |
| Smiles: | CCCCN(CC)CCCNC(C1=CN(C)c2ccc(cc2C1=O)S(N(C)C1CCCCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4549 |
| logD: | 0.7623 |
| logSw: | -3.9606 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.395 |
| InChI Key: | MJEUGUMJAFATSK-UHFFFAOYSA-N |