(4-benzylpiperazin-1-yl){5-[(4-bromobenzene-1-sulfonyl)methyl]furan-2-yl}methanone
Chemical Structure Depiction of
(4-benzylpiperazin-1-yl){5-[(4-bromobenzene-1-sulfonyl)methyl]furan-2-yl}methanone
(4-benzylpiperazin-1-yl){5-[(4-bromobenzene-1-sulfonyl)methyl]furan-2-yl}methanone
Compound characteristics
| Compound ID: | C521-0300 |
| Compound Name: | (4-benzylpiperazin-1-yl){5-[(4-bromobenzene-1-sulfonyl)methyl]furan-2-yl}methanone |
| Molecular Weight: | 503.41 |
| Molecular Formula: | C23 H23 Br N2 O4 S |
| Smiles: | C1CN(CCN1Cc1ccccc1)C(c1ccc(CS(c2ccc(cc2)[Br])(=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8045 |
| logD: | 3.7895 |
| logSw: | -3.9836 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 57.033 |
| InChI Key: | PQAVZMYUZPTPTO-UHFFFAOYSA-N |