5-[(4-bromobenzene-1-sulfonyl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
5-[(4-bromobenzene-1-sulfonyl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide
5-[(4-bromobenzene-1-sulfonyl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | C521-0340 |
| Compound Name: | 5-[(4-bromobenzene-1-sulfonyl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide |
| Molecular Weight: | 464.33 |
| Molecular Formula: | C20 H18 Br N O5 S |
| Smiles: | COc1ccccc1CNC(c1ccc(CS(c2ccc(cc2)[Br])(=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0447 |
| logD: | 4.0447 |
| logSw: | -4.2378 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.888 |
| InChI Key: | KDGCZUFGEBFBKZ-UHFFFAOYSA-N |