{5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}(4-phenylpiperazin-1-yl)methanone
Chemical Structure Depiction of
{5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}(4-phenylpiperazin-1-yl)methanone
{5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}(4-phenylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | C521-0820 |
| Compound Name: | {5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}(4-phenylpiperazin-1-yl)methanone |
| Molecular Weight: | 424.52 |
| Molecular Formula: | C23 H24 N2 O4 S |
| Smiles: | Cc1ccccc1S(Cc1ccc(C(N2CCN(CC2)c2ccccc2)=O)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7054 |
| logD: | 3.7054 |
| logSw: | -3.796 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 56.753 |
| InChI Key: | NFOYFGOLYGTURO-UHFFFAOYSA-N |