[4-(4-fluorophenyl)piperazin-1-yl]{5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}methanone
Chemical Structure Depiction of
[4-(4-fluorophenyl)piperazin-1-yl]{5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}methanone
[4-(4-fluorophenyl)piperazin-1-yl]{5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}methanone
Compound characteristics
| Compound ID: | C521-0837 |
| Compound Name: | [4-(4-fluorophenyl)piperazin-1-yl]{5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-yl}methanone |
| Molecular Weight: | 442.51 |
| Molecular Formula: | C23 H23 F N2 O4 S |
| Smiles: | Cc1ccccc1S(Cc1ccc(C(N2CCN(CC2)c2ccc(cc2)F)=O)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.856 |
| logD: | 3.856 |
| logSw: | -3.8221 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 56.753 |
| InChI Key: | SBQOPHVRVUFFOK-UHFFFAOYSA-N |