N-[2-(diethylamino)ethyl]-5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
N-[2-(diethylamino)ethyl]-5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-carboxamide
N-[2-(diethylamino)ethyl]-5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | C521-0861 |
| Compound Name: | N-[2-(diethylamino)ethyl]-5-[(2-methylbenzene-1-sulfonyl)methyl]furan-2-carboxamide |
| Molecular Weight: | 378.49 |
| Molecular Formula: | C19 H26 N2 O4 S |
| Smiles: | CCN(CC)CCNC(c1ccc(CS(c2ccccc2C)(=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6215 |
| logD: | 1.2043 |
| logSw: | -2.8109 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.782 |
| InChI Key: | PEJVQFYUTWZIDL-UHFFFAOYSA-N |