5-[(2-methylbenzene-1-sulfonyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]furan-2-carboxamide
Chemical Structure Depiction of
5-[(2-methylbenzene-1-sulfonyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]furan-2-carboxamide
5-[(2-methylbenzene-1-sulfonyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | C521-0889 |
| Compound Name: | 5-[(2-methylbenzene-1-sulfonyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]furan-2-carboxamide |
| Molecular Weight: | 419.54 |
| Molecular Formula: | C21 H29 N3 O4 S |
| Smiles: | Cc1ccccc1S(Cc1ccc(C(NCCCN2CCN(C)CC2)=O)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5141 |
| logD: | 0.3638 |
| logSw: | -2.2665 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.559 |
| InChI Key: | HTYJOPSXYANPGO-UHFFFAOYSA-N |