5-[(2-ethylbenzene-1-sulfonyl)methyl]-N-[(4-methylphenyl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
5-[(2-ethylbenzene-1-sulfonyl)methyl]-N-[(4-methylphenyl)methyl]furan-2-carboxamide
5-[(2-ethylbenzene-1-sulfonyl)methyl]-N-[(4-methylphenyl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | C521-0965 |
| Compound Name: | 5-[(2-ethylbenzene-1-sulfonyl)methyl]-N-[(4-methylphenyl)methyl]furan-2-carboxamide |
| Molecular Weight: | 397.49 |
| Molecular Formula: | C22 H23 N O4 S |
| Smiles: | CCc1ccccc1S(Cc1ccc(C(NCc2ccc(C)cc2)=O)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.317 |
| logD: | 4.317 |
| logSw: | -4.1956 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.258 |
| InChI Key: | QUWHPPCGMUCJJE-UHFFFAOYSA-N |