N-[(2-chlorophenyl)methyl]-5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
N-[(2-chlorophenyl)methyl]-5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]furan-2-carboxamide
N-[(2-chlorophenyl)methyl]-5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | C521-2122 |
| Compound Name: | N-[(2-chlorophenyl)methyl]-5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]furan-2-carboxamide |
| Molecular Weight: | 458.75 |
| Molecular Formula: | C19 H14 Cl3 N O4 S |
| Smiles: | C(c1ccccc1[Cl])NC(c1ccc(CS(c2c(cccc2[Cl])[Cl])(=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6269 |
| logD: | 4.6269 |
| logSw: | -4.6453 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.258 |
| InChI Key: | AQCMAJYVAJDKDQ-UHFFFAOYSA-N |