5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]-N-(3-methoxypropyl)furan-2-carboxamide
Chemical Structure Depiction of
5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]-N-(3-methoxypropyl)furan-2-carboxamide
5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]-N-(3-methoxypropyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | C521-2151 |
| Compound Name: | 5-[(2,6-dichlorobenzene-1-sulfonyl)methyl]-N-(3-methoxypropyl)furan-2-carboxamide |
| Molecular Weight: | 406.28 |
| Molecular Formula: | C16 H17 Cl2 N O5 S |
| Smiles: | COCCCNC(c1ccc(CS(c2c(cccc2[Cl])[Cl])(=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5372 |
| logD: | 2.5372 |
| logSw: | -2.9783 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.713 |
| InChI Key: | MAWGBNDQWVQGSS-UHFFFAOYSA-N |