2-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methanesulfinyl}-N-[(thiophen-2-yl)methyl]acetamide
Chemical Structure Depiction of
2-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methanesulfinyl}-N-[(thiophen-2-yl)methyl]acetamide
2-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methanesulfinyl}-N-[(thiophen-2-yl)methyl]acetamide
Compound characteristics
| Compound ID: | C527-0742 |
| Compound Name: | 2-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methanesulfinyl}-N-[(thiophen-2-yl)methyl]acetamide |
| Molecular Weight: | 388.51 |
| Molecular Formula: | C19 H20 N2 O3 S2 |
| Smiles: | Cc1ccc(cc1)c1nc(CS(CC(NCc2cccs2)=O)=O)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.1252 |
| logD: | 3.1252 |
| logSw: | -3.3039 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.623 |
| InChI Key: | JPDBABQLSBUXBF-UHFFFAOYSA-N |