N-[2-(4-chlorophenyl)ethyl]-2-{[5-methyl-2-(thiophen-2-yl)-1,3-oxazol-4-yl]methanesulfinyl}acetamide
Chemical Structure Depiction of
N-[2-(4-chlorophenyl)ethyl]-2-{[5-methyl-2-(thiophen-2-yl)-1,3-oxazol-4-yl]methanesulfinyl}acetamide
N-[2-(4-chlorophenyl)ethyl]-2-{[5-methyl-2-(thiophen-2-yl)-1,3-oxazol-4-yl]methanesulfinyl}acetamide
Compound characteristics
| Compound ID: | C527-2031 |
| Compound Name: | N-[2-(4-chlorophenyl)ethyl]-2-{[5-methyl-2-(thiophen-2-yl)-1,3-oxazol-4-yl]methanesulfinyl}acetamide |
| Molecular Weight: | 422.95 |
| Molecular Formula: | C19 H19 Cl N2 O3 S2 |
| Smiles: | Cc1c(CS(CC(NCCc2ccc(cc2)[Cl])=O)=O)nc(c2cccs2)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.9379 |
| logD: | 2.9379 |
| logSw: | -3.6269 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.464 |
| InChI Key: | HYGRNGSUMLIOSJ-UHFFFAOYSA-N |