N-[2-(diethylamino)ethyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
Chemical Structure Depiction of
N-[2-(diethylamino)ethyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
N-[2-(diethylamino)ethyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
Compound characteristics
| Compound ID: | C528-0842 |
| Compound Name: | N-[2-(diethylamino)ethyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide |
| Molecular Weight: | 423.53 |
| Molecular Formula: | C20 H29 N3 O5 S |
| Smiles: | CCN(CC)CCNC(CS(Cc1c(C)oc(c2cccc(c2)OC)n1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4364 |
| logD: | -0.0255 |
| logSw: | -2.4109 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.929 |
| InChI Key: | ZYPRBOSTIHPLFZ-UHFFFAOYSA-N |