N-(2,5-difluorophenyl)-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
Chemical Structure Depiction of
N-(2,5-difluorophenyl)-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
N-(2,5-difluorophenyl)-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
Compound characteristics
| Compound ID: | C528-0879 |
| Compound Name: | N-(2,5-difluorophenyl)-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide |
| Molecular Weight: | 436.43 |
| Molecular Formula: | C20 H18 F2 N2 O5 S |
| Smiles: | Cc1c(CS(CC(Nc2cc(ccc2F)F)=O)(=O)=O)nc(c2cccc(c2)OC)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.865 |
| logD: | 2.8344 |
| logSw: | -3.5192 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.384 |
| InChI Key: | ZRYGBQJNXVEYFP-UHFFFAOYSA-N |