N-[3-(4-ethylpiperazin-1-yl)propyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
Chemical Structure Depiction of
N-[3-(4-ethylpiperazin-1-yl)propyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
N-[3-(4-ethylpiperazin-1-yl)propyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide
Compound characteristics
| Compound ID: | C528-0936 |
| Compound Name: | N-[3-(4-ethylpiperazin-1-yl)propyl]-2-{[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methanesulfonyl}acetamide |
| Molecular Weight: | 478.61 |
| Molecular Formula: | C23 H34 N4 O5 S |
| Smiles: | CCN1CCN(CCCNC(CS(Cc2c(C)oc(c3cccc(c3)OC)n2)(=O)=O)=O)CC1 |
| Stereo: | ACHIRAL |
| logP: | 0.6738 |
| logD: | -0.2744 |
| logSw: | -2.2423 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.765 |
| InChI Key: | UBKFIDOICRSPGL-UHFFFAOYSA-N |