3-methyl-N-(4-methylphenyl)-1-phenyl-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
3-methyl-N-(4-methylphenyl)-1-phenyl-1H-pyrazole-5-carboxamide
3-methyl-N-(4-methylphenyl)-1-phenyl-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | C532-1662 |
| Compound Name: | 3-methyl-N-(4-methylphenyl)-1-phenyl-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 291.35 |
| Molecular Formula: | C18 H17 N3 O |
| Smiles: | Cc1ccc(cc1)NC(c1cc(C)nn1c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4043 |
| logD: | 3.4043 |
| logSw: | -3.6218 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.231 |
| InChI Key: | MSVLNCDLZIURJJ-UHFFFAOYSA-N |