3,8-dimethyl-2-oxo-N-(2,3,5,6-tetrafluorophenyl)-1-oxaspiro[4.5]dec-3-ene-4-carboxamide
Chemical Structure Depiction of
3,8-dimethyl-2-oxo-N-(2,3,5,6-tetrafluorophenyl)-1-oxaspiro[4.5]dec-3-ene-4-carboxamide
3,8-dimethyl-2-oxo-N-(2,3,5,6-tetrafluorophenyl)-1-oxaspiro[4.5]dec-3-ene-4-carboxamide
Compound characteristics
| Compound ID: | C533-1071 |
| Compound Name: | 3,8-dimethyl-2-oxo-N-(2,3,5,6-tetrafluorophenyl)-1-oxaspiro[4.5]dec-3-ene-4-carboxamide |
| Molecular Weight: | 371.33 |
| Molecular Formula: | C18 H17 F4 N O3 |
| Smiles: | CC1CCC2(CC1)C(=C(C)C(=O)O2)C(Nc1c(c(cc(c1F)F)F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8004 |
| logD: | 0.0561 |
| logSw: | -3.9778 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.76 |
| InChI Key: | JONINTOLDNINEK-UHFFFAOYSA-N |