N-[3-(diethylamino)propyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide
Chemical Structure Depiction of
N-[3-(diethylamino)propyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide
N-[3-(diethylamino)propyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide
Compound characteristics
| Compound ID: | C540-0047 |
| Compound Name: | N-[3-(diethylamino)propyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| Molecular Weight: | 370.52 |
| Molecular Formula: | C20 H26 N4 O S |
| Smiles: | CCN(CC)CCCNC(c1c(C)n2cc(c3ccccc3)nc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4659 |
| logD: | 0.7449 |
| logSw: | -3.478 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.379 |
| InChI Key: | BRIWWKGJMLDFNS-UHFFFAOYSA-N |