(4-ethylpiperazin-1-yl)[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methanone
Chemical Structure Depiction of
(4-ethylpiperazin-1-yl)[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methanone
(4-ethylpiperazin-1-yl)[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methanone
Compound characteristics
| Compound ID: | C540-0127 |
| Compound Name: | (4-ethylpiperazin-1-yl)[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methanone |
| Molecular Weight: | 372.46 |
| Molecular Formula: | C19 H21 F N4 O S |
| Smiles: | CCN1CCN(CC1)C(c1c(C)n2cc(c3ccc(cc3)F)nc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0103 |
| logD: | 2.8405 |
| logSw: | -2.8487 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.6269 |
| InChI Key: | CXTXKKSTMMXPTF-UHFFFAOYSA-N |