6-(4-methoxyphenyl)-3-methyl-N-(2-methylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide
Chemical Structure Depiction of
6-(4-methoxyphenyl)-3-methyl-N-(2-methylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide
6-(4-methoxyphenyl)-3-methyl-N-(2-methylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide
Compound characteristics
| Compound ID: | C540-0253 |
| Compound Name: | 6-(4-methoxyphenyl)-3-methyl-N-(2-methylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| Molecular Weight: | 343.45 |
| Molecular Formula: | C18 H21 N3 O2 S |
| Smiles: | CC(C)CNC(c1c(C)n2cc(c3ccc(cc3)OC)nc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7993 |
| logD: | 3.7989 |
| logSw: | -4.0164 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.671 |
| InChI Key: | MIZCAXDEHHCIJV-UHFFFAOYSA-N |