N~2~-(3,5-dimethylphenyl)-N-(4-fluorophenyl)-N~2~-(6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl)glycinamide
Chemical Structure Depiction of
N~2~-(3,5-dimethylphenyl)-N-(4-fluorophenyl)-N~2~-(6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl)glycinamide
N~2~-(3,5-dimethylphenyl)-N-(4-fluorophenyl)-N~2~-(6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | C548-1364 |
| Compound Name: | N~2~-(3,5-dimethylphenyl)-N-(4-fluorophenyl)-N~2~-(6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl)glycinamide |
| Molecular Weight: | 460.48 |
| Molecular Formula: | C21 H21 F N4 O5 S |
| Smiles: | CC1=C(C(NC(N1)=O)=O)S(N(CC(Nc1ccc(cc1)F)=O)c1cc(C)cc(C)c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5318 |
| logD: | 0.0625 |
| logSw: | -3.06 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 103.476 |
| InChI Key: | PZSVNOALBMWLTI-UHFFFAOYSA-N |