5-amino-1-[(3-bromo-4-methoxyphenyl)methyl]-N-(2,4-dimethoxyphenyl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
5-amino-1-[(3-bromo-4-methoxyphenyl)methyl]-N-(2,4-dimethoxyphenyl)-1H-1,2,3-triazole-4-carboxamide
5-amino-1-[(3-bromo-4-methoxyphenyl)methyl]-N-(2,4-dimethoxyphenyl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | C549-0832 |
| Compound Name: | 5-amino-1-[(3-bromo-4-methoxyphenyl)methyl]-N-(2,4-dimethoxyphenyl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 462.3 |
| Molecular Formula: | C19 H20 Br N5 O4 |
| Smiles: | COc1ccc(c(c1)OC)NC(c1c(N)n(Cc2ccc(c(c2)[Br])OC)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4962 |
| logD: | 2.496 |
| logSw: | -3.0063 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 91.394 |
| InChI Key: | XWQJLZCZJVCWSB-UHFFFAOYSA-N |