(2RS)-3-(benzylsulfanyl)-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-(3-phenylpropyl)propanamide
Chemical Structure Depiction of
(2RS)-3-(benzylsulfanyl)-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-(3-phenylpropyl)propanamide
(2RS)-3-(benzylsulfanyl)-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-(3-phenylpropyl)propanamide
Compound characteristics
| Compound ID: | C561-0408 |
| Compound Name: | (2RS)-3-(benzylsulfanyl)-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-(3-phenylpropyl)propanamide |
| Molecular Weight: | 444.6 |
| Molecular Formula: | C27 H28 N2 O2 S |
| Smiles: | C(Cc1ccccc1)CNC([C@H](CSCc1ccccc1)N1Cc2ccccc2C1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1651 |
| logD: | 5.1651 |
| logSw: | -5.3011 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.231 |
| InChI Key: | KQCZYNAZJPCFPN-VWLOTQADSA-N |