N-[4-(furan-2-yl)butan-2-yl]-3-(2,5,7-trimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide
Chemical Structure Depiction of
N-[4-(furan-2-yl)butan-2-yl]-3-(2,5,7-trimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide
N-[4-(furan-2-yl)butan-2-yl]-3-(2,5,7-trimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide
Compound characteristics
| Compound ID: | C561-1280 |
| Compound Name: | N-[4-(furan-2-yl)butan-2-yl]-3-(2,5,7-trimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide |
| Molecular Weight: | 430.55 |
| Molecular Formula: | C26 H30 N4 O2 |
| Smiles: | CC(CCc1ccco1)NC(CCc1c(C)nc2c(c3ccccc3)c(C)nn2c1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3265 |
| logD: | 4.3247 |
| logSw: | -4.4604 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.234 |
| InChI Key: | TYYVAWFHGOFCFS-KRWDZBQOSA-N |