N-(3,4,5-trimethoxyphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
Chemical Structure Depiction of
N-(3,4,5-trimethoxyphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
N-(3,4,5-trimethoxyphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
Compound characteristics
| Compound ID: | C561-2001 |
| Compound Name: | N-(3,4,5-trimethoxyphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide |
| Molecular Weight: | 488.59 |
| Molecular Formula: | C28 H32 N4 O4 |
| Smiles: | Cc1ccc(cc1)n1c2c(c(C)c(CCC(Nc3cc(c(c(c3)OC)OC)OC)=O)c(C)n2)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.3381 |
| logD: | 4.3347 |
| logSw: | -4.5938 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.067 |
| InChI Key: | MRJGPZLJIRCFFK-UHFFFAOYSA-N |