N~2~-(3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonyl)-N-[(4-methylphenyl)methyl]leucinamide
Chemical Structure Depiction of
N~2~-(3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonyl)-N-[(4-methylphenyl)methyl]leucinamide
N~2~-(3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonyl)-N-[(4-methylphenyl)methyl]leucinamide
Compound characteristics
| Compound ID: | C562-1126 |
| Compound Name: | N~2~-(3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonyl)-N-[(4-methylphenyl)methyl]leucinamide |
| Molecular Weight: | 445.54 |
| Molecular Formula: | C22 H27 N3 O5 S |
| Smiles: | CC(C)CC(C(NCc1ccc(C)cc1)=O)NS(c1ccc2c(c1)OC(N2C)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0592 |
| logD: | 3.0589 |
| logSw: | -3.5733 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.391 |
| InChI Key: | LKPONYANYMRSRU-SFHVURJKSA-N |