4-oxo-4-[5-({3-[(propan-2-yl)oxy]propyl}sulfamoyl)-2,3-dihydro-1H-indol-1-yl]butanoic acid
Chemical Structure Depiction of
4-oxo-4-[5-({3-[(propan-2-yl)oxy]propyl}sulfamoyl)-2,3-dihydro-1H-indol-1-yl]butanoic acid
4-oxo-4-[5-({3-[(propan-2-yl)oxy]propyl}sulfamoyl)-2,3-dihydro-1H-indol-1-yl]butanoic acid
Compound characteristics
| Compound ID: | C563-0566 |
| Compound Name: | 4-oxo-4-[5-({3-[(propan-2-yl)oxy]propyl}sulfamoyl)-2,3-dihydro-1H-indol-1-yl]butanoic acid |
| Molecular Weight: | 398.48 |
| Molecular Formula: | C18 H26 N2 O6 S |
| Smiles: | CC(C)OCCCNS(c1ccc2c(CCN2C(CCC(O)=O)=O)c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2222 |
| logD: | -1.7272 |
| logSw: | -2.3571 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.118 |
| InChI Key: | RHPGOEAUCUNHAY-UHFFFAOYSA-N |