2-[(1-ethyl-2-oxo-1,2-dihydroquinolin-4-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide
Chemical Structure Depiction of
2-[(1-ethyl-2-oxo-1,2-dihydroquinolin-4-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide
2-[(1-ethyl-2-oxo-1,2-dihydroquinolin-4-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide
Compound characteristics
| Compound ID: | C564-0015 |
| Compound Name: | 2-[(1-ethyl-2-oxo-1,2-dihydroquinolin-4-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide |
| Molecular Weight: | 430.52 |
| Molecular Formula: | C25 H22 N2 O3 S |
| Smiles: | CCN1C(C=C(c2ccccc12)SCC(Nc1ccc(cc1)Oc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9041 |
| logD: | 4.9041 |
| logSw: | -4.5308 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.241 |
| InChI Key: | CCYTYCDPKIXOMO-UHFFFAOYSA-N |