3-(3,4-dimethylbenzoyl)-1-[(3-methoxyphenyl)methyl]quinolin-4(1H)-one
Chemical Structure Depiction of
3-(3,4-dimethylbenzoyl)-1-[(3-methoxyphenyl)methyl]quinolin-4(1H)-one
3-(3,4-dimethylbenzoyl)-1-[(3-methoxyphenyl)methyl]quinolin-4(1H)-one
Compound characteristics
| Compound ID: | C567-0831 |
| Compound Name: | 3-(3,4-dimethylbenzoyl)-1-[(3-methoxyphenyl)methyl]quinolin-4(1H)-one |
| Molecular Weight: | 397.47 |
| Molecular Formula: | C26 H23 N O3 |
| Smiles: | Cc1ccc(cc1C)C(C1=CN(Cc2cccc(c2)OC)c2ccccc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2063 |
| logD: | 5.2063 |
| logSw: | -5.08 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.573 |
| InChI Key: | MUWISHRNLNVWPP-UHFFFAOYSA-N |