5-methyl-4-nitro-N-[(thiophen-2-yl)methyl]-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-methyl-4-nitro-N-[(thiophen-2-yl)methyl]-1,2-oxazole-3-carboxamide
5-methyl-4-nitro-N-[(thiophen-2-yl)methyl]-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C582-0810 |
| Compound Name: | 5-methyl-4-nitro-N-[(thiophen-2-yl)methyl]-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 267.26 |
| Molecular Formula: | C10 H9 N3 O4 S |
| Smiles: | Cc1c(c(C(NCc2cccs2)=O)no1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 1.6566 |
| logD: | 1.6565 |
| logSw: | -2.3701 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.682 |
| InChI Key: | DSYZZZRDJKULRI-UHFFFAOYSA-N |